2-(4-Bromophenyl)-5,5-dimethyl-1,3,2-dioxaborinane, 95-<97%
cas: 183677-71-6 — see every product listed under this CAS number, including other names
2-(4-Bromophenyl)-5,5-dimethyl-1,3,2-dioxaborinane, 95-<97% (CAS 183677-71-6) is a chemical reagent available from Chemat. Available pack sizes: 50g, 100g, 200g, 300g, 400g, 500g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC234-95-97-50g |
| cas | 183677-71-6 |
| size | 50g |
| availability | 3-4 tygodnie|3-4 weeks |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 50g | 4091.34 Pln | |
| Hoffman Fine Chemicals | 100g | 6356.24 Pln | |
| Hoffman Fine Chemicals | 200g | 9992.84 Pln | |
| Hoffman Fine Chemicals | 300g | 11925.98 Pln | |
| Hoffman Fine Chemicals | 400g | 14248.30 Pln | |
| Hoffman Fine Chemicals | 500g | 15990.04 Pln |
properties
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
2-(4-bromophenyl)-5,5-dimethyl-1,3,2-dioxaborinane (CAS 183677-71-6) is a chemical compound with the molecular formula C11H14BBrO2 and a molecular weight of 268.94 g/mol. IUPAC name: 2-(4-bromophenyl)-5,5-dimethyl-1,3,2-dioxaborinane. InChIKey: GUASPWAWPYERCR-UHFFFAOYSA-N.
| Molecular formula | C11H14BBrO2 |
|---|---|
| Molecular weight | 268.94 g/mol |
| IUPAC name | 2-(4-bromophenyl)-5,5-dimethyl-1,3,2-dioxaborinane |
| InChIKey | GUASPWAWPYERCR-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)
Synonyms:
2-(4-bromophenyl)-5,5-dimethyl-1,3,2-dioxaborinane, 4-Bromobenzeneboronic acid neopentyl glycol ester, 4-Bromophenylboronic acid neopentyl glycol ester, C11H14BBrO2, 4-Bromophenylboronic acid neopentyl glycol cyclic ester, 4-Bromobenzeneboronic acid neopentyl glycol cyclic ester, 4-Bromophenylboronic acidneopentylglycol ester, 1,3,2-Dioxaborinane, 2-(4-bromophenyl)-5,5-dimethyl-