2-(4-Bromophenyl)-5,5-dimethyl-1,3,2-dioxaborinane, 98%
cas: 183677-71-6 — see every product listed under this CAS number, including other names
2-(4-Bromophenyl)-5,5-dimethyl-1,3,2-dioxaborinane, 98% (CAS 183677-71-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F691563-250MG |
| cas | 183677-71-6 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 128.10 Pln | |
| Fluorochem | 1g | 216.61 Pln | |
| Fluorochem | 5g | 570.65 Pln | |
| Fluorochem | 25g | 2606.39 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-(4-bromophenyl)-5,5-dimethyl-1,3,2-dioxaborinane (CAS 183677-71-6) is a chemical compound with the molecular formula C11H14BBrO2 and a molecular weight of 268.94 g/mol. IUPAC name: 2-(4-bromophenyl)-5,5-dimethyl-1,3,2-dioxaborinane. InChIKey: GUASPWAWPYERCR-UHFFFAOYSA-N.
| Molecular formula | C11H14BBrO2 |
|---|---|
| Molecular weight | 268.94 g/mol |
| IUPAC name | 2-(4-bromophenyl)-5,5-dimethyl-1,3,2-dioxaborinane |
| InChIKey | GUASPWAWPYERCR-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)
Synonyms:
2-(4-bromophenyl)-5,5-dimethyl-1,3,2-dioxaborinane, 4-Bromobenzeneboronic acid neopentyl glycol ester, 4-Bromophenylboronic acid neopentyl glycol ester, C11H14BBrO2, 4-Bromophenylboronic acid neopentyl glycol cyclic ester, 4-Bromobenzeneboronic acid neopentyl glycol cyclic ester, 4-Bromophenylboronic acidneopentylglycol ester, 1,3,2-Dioxaborinane, 2-(4-bromophenyl)-5,5-dimethyl-