cas: 22421-88-1 — see every product listed under this CAS number, including other names
2-(4-Bromophenyl)acetophenone 95% (CAS 22421-88-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A583552-5g |
| cas | 22421-88-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 359.25 Pln | |
| Ambeed | 25g | 1060.12 Pln | |
| Ambeed | 100g | 3340.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A583552 |
2-(4-bromophenyl)-1-phenylethanone (CAS 22421-88-1) is a chemical compound with the molecular formula C14H11BrO and a molecular weight of 275.14 g/mol. IUPAC name: 2-(4-bromophenyl)-1-phenylethanone. InChIKey: GPTAKAWFMITEOL-UHFFFAOYSA-N.
| Molecular formula | C14H11BrO |
|---|---|
| Molecular weight | 275.14 g/mol |
| IUPAC name | 2-(4-bromophenyl)-1-phenylethanone |
| InChIKey | GPTAKAWFMITEOL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)CC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)