cas: 22421-88-1 — see every product listed under this CAS number, including other names
2-(4-Bromophenyl)acetophenone, 97%, 97% (CAS 22421-88-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C3AQ-1g |
| cas | 22421-88-1 |
| size | 1g |
| availability | 400g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 275.60 Pln | |
| Chemat | 10g | 448.40 Pln | |
| Chemat | 25g | 813.20 Pln | |
| Chemat | 100g | 2656.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(4-bromophenyl)-1-phenylethanone (CAS 22421-88-1) is a chemical compound with the molecular formula C14H11BrO and a molecular weight of 275.14 g/mol. IUPAC name: 2-(4-bromophenyl)-1-phenylethanone. InChIKey: GPTAKAWFMITEOL-UHFFFAOYSA-N.
| Molecular formula | C14H11BrO |
|---|---|
| Molecular weight | 275.14 g/mol |
| IUPAC name | 2-(4-bromophenyl)-1-phenylethanone |
| InChIKey | GPTAKAWFMITEOL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)CC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)