cas: 452914-21-5 — see every product listed under this CAS number, including other names
2-(4-Butoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 95+% (CAS 452914-21-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A222882-250mg |
| cas | 452914-21-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 620.69 Pln | |
| Ambeed | 5g | 2033.56 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A222882 |
2-(4-butoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 452914-21-5) is a chemical compound with the molecular formula C16H25BO3 and a molecular weight of 276.2 g/mol. IUPAC name: 2-(4-butoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: VJLYRKSJEHDMPS-UHFFFAOYSA-N.
| Molecular formula | C16H25BO3 |
|---|---|
| Molecular weight | 276.2 g/mol |
| IUPAC name | 2-(4-butoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | VJLYRKSJEHDMPS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OCCCC |
Computed by PubChem (NCBI)