cas: 625458-85-7 — see every product listed under this CAS number, including other names
2-(4-Butylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 95% (CAS 625458-85-7) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EL0Z-5g |
| cas | 625458-85-7 |
| size | 5g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 784.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(4-butylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 625458-85-7) is a chemical compound with the molecular formula C16H25BO2 and a molecular weight of 260.2 g/mol. IUPAC name: 2-(4-butylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: CUOOVGGNLPMDIC-UHFFFAOYSA-N.
| Molecular formula | C16H25BO2 |
|---|---|
| Molecular weight | 260.2 g/mol |
| IUPAC name | 2-(4-butylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | CUOOVGGNLPMDIC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CCCC |
Computed by PubChem (NCBI)