Products 516510-90-0

CAS 516510-90-0 is the registry number for 4-(trans-4-Butylcyclohexyl)phenylboronic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g.

Structural formula: {0} (CAS {1})

[4-(4-butylcyclohexyl)phenyl]boronic acid (CAS 516510-90-0) is a chemical compound with the molecular formula C16H25BO2 and a molecular weight of 260.2 g/mol. IUPAC name: [4-(4-butylcyclohexyl)phenyl]boronic acid. InChIKey: XAPVHVFVQKPDAJ-UHFFFAOYSA-N.

Identity
Molecular formulaC16H25BO2
Molecular weight260.2 g/mol
IUPAC name[4-(4-butylcyclohexyl)phenyl]boronic acid
InChIKeyXAPVHVFVQKPDAJ-UHFFFAOYSA-N
SMILESB(C1=CC=C(C=C1)C2CCC(CC2)CCCC)(O)O

Computed by PubChem (NCBI)