CAS 1268242-41-6 appears in our catalog under these names: 4-sec-Butylphenylboronic acid pinacol ester, 97%, 2-(4-(sec-Butyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 98%, 4-sec-Butylphenylboronic acid pinacol ester, 98%, 98%, 2-(4-(Sec-butyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg.
2-(4-butan-2-ylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1268242-41-6) is a chemical compound with the molecular formula C16H25BO2 and a molecular weight of 260.2 g/mol. IUPAC name: 2-(4-butan-2-ylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: KFJSDLRVUFZWGX-UHFFFAOYSA-N.
| Molecular formula | C16H25BO2 |
|---|---|
| Molecular weight | 260.2 g/mol |
| IUPAC name | 2-(4-butan-2-ylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | KFJSDLRVUFZWGX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(C)CC |
Computed by PubChem (NCBI)