CAS 625458-85-7 appears in our catalog under these names: 2-(4-butylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 4–Butylphenylboronic acid pinacol ester, 2-(4-Butylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 95%, 2-(4-Butylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
2-(4-butylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 625458-85-7) is a chemical compound with the molecular formula C16H25BO2 and a molecular weight of 260.2 g/mol. IUPAC name: 2-(4-butylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: CUOOVGGNLPMDIC-UHFFFAOYSA-N.
| Molecular formula | C16H25BO2 |
|---|---|
| Molecular weight | 260.2 g/mol |
| IUPAC name | 2-(4-butylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | CUOOVGGNLPMDIC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CCCC |
Computed by PubChem (NCBI)