cas: 72293-68-6 — see every product listed under this CAS number, including other names
2-(4-Chloro-3-methylphenoxy)acetohydrazide, 98%, 98% (CAS 72293-68-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1178OY-100mg |
| cas | 72293-68-6 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 1g | 251.60 Pln | |
| Chemat | 5g | 813.20 Pln | |
| Chemat | 10g | 1254.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(4-chloro-3-methylphenoxy)acetohydrazide (CAS 72293-68-6) is a chemical compound with the molecular formula C9H11ClN2O2 and a molecular weight of 214.65 g/mol. IUPAC name: 2-(4-chloro-3-methylphenoxy)acetohydrazide. InChIKey: DLFJAQDMJDJPKW-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O2 |
|---|---|
| Molecular weight | 214.65 g/mol |
| IUPAC name | 2-(4-chloro-3-methylphenoxy)acetohydrazide |
| InChIKey | DLFJAQDMJDJPKW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OCC(=O)NN)Cl |
Computed by PubChem (NCBI)