CAS 73536-87-5 appears in our catalog under these names: 2-Amino-5-nitroindan hydrochloride, 5-Nitro-indan-2-ylamine hydrochloride, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 1000mg, 500mg, 2000mg, 5000mg, 250mg, 5g, 25g, 1g.
5-nitro-2,3-dihydro-1H-inden-2-amine;hydrochloride (CAS 73536-87-5) is a chemical compound with the molecular formula C9H11ClN2O2 and a molecular weight of 214.65 g/mol. IUPAC name: 5-nitro-2,3-dihydro-1H-inden-2-amine;hydrochloride. InChIKey: FFGLVSGGGJOMQY-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O2 |
|---|---|
| Molecular weight | 214.65 g/mol |
| IUPAC name | 5-nitro-2,3-dihydro-1H-inden-2-amine;hydrochloride |
| InChIKey | FFGLVSGGGJOMQY-UHFFFAOYSA-N |
| SMILES | C1C(CC2=C1C=CC(=C2)[N+](=O)[O-])N.Cl |
Computed by PubChem (NCBI)