CAS 1269087-70-8 appears in our catalog under these names: 6-Amino-3-ethyl-1,3-benzoxazol-2(3h)-one hydrochloride, 95%, 6-Amino-3-ethyl-1,3-benzoxazol-2(3H)-one hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
6-amino-3-ethyl-1,3-benzoxazol-2-one;hydrochloride (CAS 1269087-70-8) is a chemical compound with the molecular formula C9H11ClN2O2 and a molecular weight of 214.65 g/mol. IUPAC name: 6-amino-3-ethyl-1,3-benzoxazol-2-one;hydrochloride. InChIKey: BVADWVOMHZRPFL-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O2 |
|---|---|
| Molecular weight | 214.65 g/mol |
| IUPAC name | 6-amino-3-ethyl-1,3-benzoxazol-2-one;hydrochloride |
| InChIKey | BVADWVOMHZRPFL-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)N)OC1=O.Cl |
Computed by PubChem (NCBI)