Products 169335-49-3

CAS 169335-49-3 is the registry number for 5-Chloro-pyrazine-2-carboxylic acid isobutyl ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-methylpropyl 5-chloropyrazine-2-carboxylate (CAS 169335-49-3) is a chemical compound with the molecular formula C9H11ClN2O2 and a molecular weight of 214.65 g/mol. IUPAC name: 2-methylpropyl 5-chloropyrazine-2-carboxylate. InChIKey: OFWXMCXGANWSRI-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11ClN2O2
Molecular weight214.65 g/mol
IUPAC name2-methylpropyl 5-chloropyrazine-2-carboxylate
InChIKeyOFWXMCXGANWSRI-UHFFFAOYSA-N
SMILESCC(C)COC(=O)C1=CN=C(C=N1)Cl

Computed by PubChem (NCBI)