CAS 169335-49-3 is the registry number for 5-Chloro-pyrazine-2-carboxylic acid isobutyl ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
2-methylpropyl 5-chloropyrazine-2-carboxylate (CAS 169335-49-3) is a chemical compound with the molecular formula C9H11ClN2O2 and a molecular weight of 214.65 g/mol. IUPAC name: 2-methylpropyl 5-chloropyrazine-2-carboxylate. InChIKey: OFWXMCXGANWSRI-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O2 |
|---|---|
| Molecular weight | 214.65 g/mol |
| IUPAC name | 2-methylpropyl 5-chloropyrazine-2-carboxylate |
| InChIKey | OFWXMCXGANWSRI-UHFFFAOYSA-N |
| SMILES | CC(C)COC(=O)C1=CN=C(C=N1)Cl |
Computed by PubChem (NCBI)