2-(4-Chlorobenzyl)-4，4，5，5-tetramethyl-1，3，2-dioxaborolane, 96%, 96%
cas: 475250-49-8 — see every product listed under this CAS number, including other names
2-(4-Chlorobenzyl)-4，4，5，5-tetramethyl-1，3，2-dioxaborolane, 96%, 96% (CAS 475250-49-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DHXM-100mg |
| cas | 475250-49-8 |
| size | 100mg |
| availability | 75g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 750.80 Pln | |
| Chemat | 10g | 1322.00 Pln | |
| Chemat | 25g | 2584.40 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-[(4-chlorophenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 475250-49-8) is a chemical compound with the molecular formula C13H18BClO2 and a molecular weight of 252.55 g/mol. IUPAC name: 2-[(4-chlorophenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: JDACVUOXXNUDGH-UHFFFAOYSA-N.
| Molecular formula | C13H18BClO2 |
|---|---|
| Molecular weight | 252.55 g/mol |
| IUPAC name | 2-[(4-chlorophenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | JDACVUOXXNUDGH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)
Synonyms:
2-[(4-chlorophenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2-((4-Chlorophenyl)methyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2-(4-Chlorobenzyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 4-Chlorobenzylboronic Acid Pinacol Ester, 2-(4-Chloro-benzyl)-4,4,5,5-tetramethyl-[1,3,2]dioxaborolane, JDACVUOXXNUDGH-UHFFFAOYSA-N, 2-(4-Chlorobenzyl)-4455-tetramethyl-132-dioxaborolane