cas: 1211-35-4 — see every product listed under this CAS number, including other names
2-(4-Chlorophenyl)-1H-indole, 98% (CAS 1211-35-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F223766-100MG |
| cas | 1211-35-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 159.34 Pln | |
| Fluorochem | 250mg | 190.58 Pln | |
| Fluorochem | 1g | 346.77 Pln | |
| Fluorochem | 5g | 872.63 Pln | |
| Fluorochem | 10g | 1690.05 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-(4-chlorophenyl)-1H-indole (CAS 1211-35-4) is a chemical compound with the molecular formula C14H10ClN and a molecular weight of 227.69 g/mol. IUPAC name: 2-(4-chlorophenyl)-1H-indole. InChIKey: KDNXKQSAAZNUCK-UHFFFAOYSA-N.
| Molecular formula | C14H10ClN |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-1H-indole |
| InChIKey | KDNXKQSAAZNUCK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(N2)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)