CAS 23746-76-1 appears in our catalog under these names: 5-Chloro-2-phenyl-1h-indole, 95%, 5-Chloro-2-phenyl-1H-indole, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 1g, 5g, 250mg, 100mg, 50mg.
5-chloro-2-phenyl-1H-indole (CAS 23746-76-1) is a chemical compound with the molecular formula C14H10ClN and a molecular weight of 227.69 g/mol. IUPAC name: 5-chloro-2-phenyl-1H-indole. InChIKey: GQGZSWYJDNGSBE-UHFFFAOYSA-N.
| Molecular formula | C14H10ClN |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | 5-chloro-2-phenyl-1H-indole |
| InChIKey | GQGZSWYJDNGSBE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(N2)C=CC(=C3)Cl |
Computed by PubChem (NCBI)