CAS 1365272-10-1 is the registry number for 3-(2-Chloro-5-methylphenyl)benzonitrile, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
3-(2-chloro-5-methylphenyl)benzonitrile (CAS 1365272-10-1) is a chemical compound with the molecular formula C14H10ClN and a molecular weight of 227.69 g/mol. IUPAC name: 3-(2-chloro-5-methylphenyl)benzonitrile. InChIKey: QQBHRDQAVTUTHL-UHFFFAOYSA-N.
| Molecular formula | C14H10ClN |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | 3-(2-chloro-5-methylphenyl)benzonitrile |
| InChIKey | QQBHRDQAVTUTHL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)Cl)C2=CC=CC(=C2)C#N |
Computed by PubChem (NCBI)