CAS 253679-13-9 is the registry number for 3-(3-Chloro-4-methylphenyl)benzonitrile, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-(3-chloro-4-methylphenyl)benzonitrile (CAS 253679-13-9) is a chemical compound with the molecular formula C14H10ClN and a molecular weight of 227.69 g/mol. IUPAC name: 3-(3-chloro-4-methylphenyl)benzonitrile. InChIKey: UHBIPJZPCKGXMO-UHFFFAOYSA-N.
| Molecular formula | C14H10ClN |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | 3-(3-chloro-4-methylphenyl)benzonitrile |
| InChIKey | UHBIPJZPCKGXMO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=CC=CC(=C2)C#N)Cl |
Computed by PubChem (NCBI)