cas: 6332-83-8 — see every product listed under this CAS number, including other names
2-(4-Chlorophenyl)acetophenone, 97% (CAS 6332-83-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F022880-250MG |
| cas | 6332-83-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 174.96 Pln | |
| Fluorochem | 1g | 268.67 Pln | |
| Fluorochem | 5g | 778.91 Pln | |
| Fluorochem | 10g | 1497.41 Pln | |
| Fluorochem | 25g | 3496.70 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-(4-chlorophenyl)-1-phenylethanone (CAS 6332-83-8) is a chemical compound with the molecular formula C14H11ClO and a molecular weight of 230.69 g/mol. IUPAC name: 2-(4-chlorophenyl)-1-phenylethanone. InChIKey: HGIDMJOUQKOWMX-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO |
|---|---|
| Molecular weight | 230.69 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-1-phenylethanone |
| InChIKey | HGIDMJOUQKOWMX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)CC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)