cas: 721920-84-9 — see every product listed under this CAS number, including other names
2-(4-Chlorophenyl)thiazole-5-carbaldehyde, 99% (CAS 721920-84-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F078804-1G |
| cas | 721920-84-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1695.25 Pln | |
| Fluorochem | 5g | 5751.12 Pln |
| purity | 99% |
|---|---|
| delivery time | 3-4 weeks |
2-(4-chlorophenyl)-1,3-thiazole-5-carbaldehyde (CAS 721920-84-9) is a chemical compound with the molecular formula C10H6ClNOS and a molecular weight of 223.68 g/mol. IUPAC name: 2-(4-chlorophenyl)-1,3-thiazole-5-carbaldehyde. InChIKey: QJHQBOBUAOFVLH-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNOS |
|---|---|
| Molecular weight | 223.68 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-1,3-thiazole-5-carbaldehyde |
| InChIKey | QJHQBOBUAOFVLH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC=C(S2)C=O)Cl |
Computed by PubChem (NCBI)