CAS 1269477-36-2 is the registry number for 5-(3-Chlorophenyl)thiazole-2-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(3-chlorophenyl)-1,3-thiazole-2-carbaldehyde (CAS 1269477-36-2) is a chemical compound with the molecular formula C10H6ClNOS and a molecular weight of 223.68 g/mol. IUPAC name: 5-(3-chlorophenyl)-1,3-thiazole-2-carbaldehyde. InChIKey: OCRCTTJUZPGUDU-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNOS |
|---|---|
| Molecular weight | 223.68 g/mol |
| IUPAC name | 5-(3-chlorophenyl)-1,3-thiazole-2-carbaldehyde |
| InChIKey | OCRCTTJUZPGUDU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=CN=C(S2)C=O |
Computed by PubChem (NCBI)