Products 36094-04-9
CAS 36094-04-9 appears in our catalog under these names: 2-Phenyl-1,3-thiazole-4-carbonyl chloride, 95%, 2-Phenyl-1,3-thiazole-4-carbonyl chloride, 95% , 2-Phenylthiazole-4-carbonyl chloride, 97%. Offered by: Combi-blocks, Thermo Scientific, Ambeed, BLDpharm. Available pack sizes: 1g, 250mg, 5g, 100mg.
2-phenyl-1,3-thiazole-4-carbonyl chloride (CAS 36094-04-9) is a chemical compound with the molecular formula C10H6ClNOS and a molecular weight of 223.68 g/mol. IUPAC name: 2-phenyl-1,3-thiazole-4-carbonyl chloride. InChIKey: ZZFOIDMEHXGBKS-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNOS |
|---|---|
| Molecular weight | 223.68 g/mol |
| IUPAC name | 2-phenyl-1,3-thiazole-4-carbonyl chloride |
| InChIKey | ZZFOIDMEHXGBKS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=CS2)C(=O)Cl |
Computed by PubChem (NCBI)