CAS 21278-77-3 appears in our catalog under these names: 2-(4-Chloro-phenyl)-thiazole-4-carbaldehyde, 95%, 2-(4-Chlorophenyl)thiazole-4-carbaldehyde. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10G, 1g, 250mg, 500mg, 1000mg, 2000mg, 5000mg.
2-(4-chlorophenyl)-1,3-thiazole-4-carbaldehyde (CAS 21278-77-3) is a chemical compound with the molecular formula C10H6ClNOS and a molecular weight of 223.68 g/mol. IUPAC name: 2-(4-chlorophenyl)-1,3-thiazole-4-carbaldehyde. InChIKey: QVEJNZQGJYCMKA-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNOS |
|---|---|
| Molecular weight | 223.68 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-1,3-thiazole-4-carbaldehyde |
| InChIKey | QVEJNZQGJYCMKA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=CS2)C=O)Cl |
Computed by PubChem (NCBI)