2-(4-Cyanophenyl)propanoic acid, 95%
cas: 362052-00-4 — see every product listed under this CAS number, including other names
2-(4-Cyanophenyl)propanoic acid, 95% (CAS 362052-00-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A159754-250mg |
| cas | 362052-00-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 520.56 Pln | |
| Ambeed | 5g | 1366.06 Pln | |
| Ambeed | 10g | 2422.94 Pln | |
| BLDpharm | 100mg | 253.27 Pln | |
| BLDpharm | 250mg | 297.70 Pln | |
| BLDpharm | 1g | 553.16 Pln | |
| BLDpharm | 5g | 1469.51 Pln | |
| BLDpharm | 10g | 2608.00 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2-(4-cyanophenyl)propanoic acid (CAS 362052-00-4) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 175.18 g/mol. IUPAC name: 2-(4-cyanophenyl)propanoic acid. InChIKey: YSVNGBYVEJEXGO-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | 2-(4-cyanophenyl)propanoic acid |
| InChIKey | YSVNGBYVEJEXGO-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)C#N)C(=O)O |
Computed by PubChem (NCBI)