CAS 34058-50-9 appears in our catalog under these names: 2-Methyl-1h-indole-4-carboxylic acid, 95%, 2-Methyl-1H-indole-4-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 250mg, 10g, 5g, 1g, 0,5g, 50mg.
2-methyl-1H-indole-4-carboxylic acid (CAS 34058-50-9) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 175.18 g/mol. IUPAC name: 2-methyl-1H-indole-4-carboxylic acid. InChIKey: NUBJHNKCWFUFKW-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | 2-methyl-1H-indole-4-carboxylic acid |
| InChIKey | NUBJHNKCWFUFKW-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=CC=C2N1)C(=O)O |
Computed by PubChem (NCBI)