CAS 306297-19-8 appears in our catalog under these names: 4-Cyano-2,6-dimethylbenzoic acid, 97%, 4-Cyano-2,6-dimethylbenzoic acid, 98%, 4-Cyano-2,6-dimethylbenzoic acid, 95%, 95%, 4-Cyano-2,6-dimethylbenzoic acid, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 10g, 5g.
4-cyano-2,6-dimethylbenzoic acid (CAS 306297-19-8) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 175.18 g/mol. IUPAC name: 4-cyano-2,6-dimethylbenzoic acid. InChIKey: DTIYQZWKQOIDBX-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | 4-cyano-2,6-dimethylbenzoic acid |
| InChIKey | DTIYQZWKQOIDBX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C(=O)O)C)C#N |
Computed by PubChem (NCBI)