CAS 362052-00-4 appears in our catalog under these names: 2-(4-Cyanophenyl)propanoic acid, 2-(4-Cyanophenyl)propanoic acid, 98%, 2-(4-Cyanophenyl)propanoic acid, 95%, 2-(4-Cyano-phenyl)-propionic acid, 95%. Offered by: Biosynth, Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 2,5g, 100mg, 250mg, 1g, 5g, 10g.
2-(4-cyanophenyl)propanoic acid (CAS 362052-00-4) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 175.18 g/mol. IUPAC name: 2-(4-cyanophenyl)propanoic acid. InChIKey: YSVNGBYVEJEXGO-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | 2-(4-cyanophenyl)propanoic acid |
| InChIKey | YSVNGBYVEJEXGO-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)C#N)C(=O)O |
Computed by PubChem (NCBI)