cas: 2121513-90-2 — see every product listed under this CAS number, including other names
2-(4-Cyclobutylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95% (CAS 2121513-90-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A827054-1g |
| cas | 2121513-90-2 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 6762.28 Pln | |
| AmBeed | 5g | 20153.35 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(4-cyclobutylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121513-90-2) is a chemical compound with the molecular formula C16H23BO2 and a molecular weight of 258.2 g/mol. IUPAC name: 2-(4-cyclobutylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: RMTDYBAOBXTZCV-UHFFFAOYSA-N.
| Molecular formula | C16H23BO2 |
|---|---|
| Molecular weight | 258.2 g/mol |
| IUPAC name | 2-(4-cyclobutylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | RMTDYBAOBXTZCV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C3CCC3 |
Computed by PubChem (NCBI)