CAS 2223036-65-3 appears in our catalog under these names: 2-(2-Cyclopropyl-6-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 2-(2-Cyclopropyl-6-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, 97%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g, 5g.
2-(2-cyclopropyl-6-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2223036-65-3) is a chemical compound with the molecular formula C16H23BO2 and a molecular weight of 258.2 g/mol. IUPAC name: 2-(2-cyclopropyl-6-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: IBMLYLZLYISSMB-UHFFFAOYSA-N.
| Molecular formula | C16H23BO2 |
|---|---|
| Molecular weight | 258.2 g/mol |
| IUPAC name | 2-(2-cyclopropyl-6-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | IBMLYLZLYISSMB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC=C2C3CC3)C |
Computed by PubChem (NCBI)