cas: 1034287-04-1 — see every product listed under this CAS number, including other names
2-(4-Ethynyl-phenyl)-4,4,5,5-tetramethyl-[1,3,2]-dioxaborolane 95% (CAS 1034287-04-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A155711-100mg |
| cas | 1034287-04-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 159.00 Pln | |
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 459.38 Pln | |
| Ambeed | 5g | 1638.62 Pln | |
| Ambeed | 25g | 6761.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A155711 |
2-(4-ethynylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1034287-04-1) is a chemical compound with the molecular formula C14H17BO2 and a molecular weight of 228.10 g/mol. IUPAC name: 2-(4-ethynylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: LOVNTFMVZVIASV-UHFFFAOYSA-N.
| Molecular formula | C14H17BO2 |
|---|---|
| Molecular weight | 228.10 g/mol |
| IUPAC name | 2-(4-ethynylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | LOVNTFMVZVIASV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C#C |
Computed by PubChem (NCBI)