cas: 1187174-10-2 — see every product listed under this CAS number, including other names
2-(4-FLUOROPHENYL)PIPERIDINE HCL, 98% (CAS 1187174-10-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F305916-250MG |
| cas | 1187174-10-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 737.26 Pln | |
| Fluorochem | 500mg | 1028.82 Pln | |
| Fluorochem | 1g | 1559.89 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-(4-fluorophenyl)piperidine;hydrochloride (CAS 1187174-10-2) is a chemical compound with the molecular formula C11H15ClFN and a molecular weight of 215.69 g/mol. IUPAC name: 2-(4-fluorophenyl)piperidine;hydrochloride. InChIKey: YAVUREZBMQVFFY-UHFFFAOYSA-N.
| Molecular formula | C11H15ClFN |
|---|---|
| Molecular weight | 215.69 g/mol |
| IUPAC name | 2-(4-fluorophenyl)piperidine;hydrochloride |
| InChIKey | YAVUREZBMQVFFY-UHFFFAOYSA-N |
| SMILES | C1CCNC(C1)C2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)