cas: 2432848-80-9 — see every product listed under this CAS number, including other names
2-(4-Fluoro-3-methoxyphenyl)-2-methyl-1,3-dioxolane, 98% (CAS 2432848-80-9) is a chemical reagent available from Chemat. Available pack sizes: 25g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1656656-25g |
| cas | 2432848-80-9 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 14541.73 Pln | |
| AmBeed | 10g | 7432.81 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(4-fluoro-3-methoxyphenyl)-2-methyl-1,3-dioxolane (CAS 2432848-80-9) is a chemical compound with the molecular formula C11H13FO3 and a molecular weight of 212.22 g/mol. IUPAC name: 2-(4-fluoro-3-methoxyphenyl)-2-methyl-1,3-dioxolane. InChIKey: FMRZLBQOBPMQLW-UHFFFAOYSA-N.
| Molecular formula | C11H13FO3 |
|---|---|
| Molecular weight | 212.22 g/mol |
| IUPAC name | 2-(4-fluoro-3-methoxyphenyl)-2-methyl-1,3-dioxolane |
| InChIKey | FMRZLBQOBPMQLW-UHFFFAOYSA-N |
| SMILES | CC1(OCCO1)C2=CC(=C(C=C2)F)OC |
Computed by PubChem (NCBI)