Products 2404733-89-5
CAS 2404733-89-5 appears in our catalog under these names: 4-Fluoro-3-isopropoxy-5-methylbenzoic acid, 95%, 4-Fluoro-3-isopropoxy-5-methylbenzoic acid, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 10g, 25g, 5g, 250mg, 1g.
4-fluoro-3-methyl-5-propan-2-yloxybenzoic acid (CAS 2404733-89-5) is a chemical compound with the molecular formula C11H13FO3 and a molecular weight of 212.22 g/mol. IUPAC name: 4-fluoro-3-methyl-5-propan-2-yloxybenzoic acid. InChIKey: IEXFDIPCTQWHBP-UHFFFAOYSA-N.
| Molecular formula | C11H13FO3 |
|---|---|
| Molecular weight | 212.22 g/mol |
| IUPAC name | 4-fluoro-3-methyl-5-propan-2-yloxybenzoic acid |
| InChIKey | IEXFDIPCTQWHBP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1F)OC(C)C)C(=O)O |
Computed by PubChem (NCBI)