Products 347867-75-8
CAS 347867-75-8 appears in our catalog under these names: 5-(4-Fluorophenoxy)-n-valeric acid, 95%, 5-(4-Fluorophenoxy)valeric Acid, 98%, 5-(4-Fluorophenoxy)valeric Acid, >98.0%(T)(GC), 5-(4-Fluorophenoxy)-N-Valeric Acid, ≥98%, ≥98%, 5-(4-Fluorophenoxy)pentanoic acid. Offered by: Combi-blocks, AmBeed, TCI, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 1g.
5-(4-fluorophenoxy)pentanoic acid (CAS 347867-75-8) is a chemical compound with the molecular formula C11H13FO3 and a molecular weight of 212.22 g/mol. IUPAC name: 5-(4-fluorophenoxy)pentanoic acid. InChIKey: SNUHBWJBUYDESY-UHFFFAOYSA-N.
| Molecular formula | C11H13FO3 |
|---|---|
| Molecular weight | 212.22 g/mol |
| IUPAC name | 5-(4-fluorophenoxy)pentanoic acid |
| InChIKey | SNUHBWJBUYDESY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OCCCCC(=O)O)F |
Computed by PubChem (NCBI)