Products 189012-54-2

CAS 189012-54-2 is the registry number for 3-[2-(4-Fluorophenyl)ethoxy]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-[2-(4-fluorophenyl)ethoxy]propanoic acid (CAS 189012-54-2) is a chemical compound with the molecular formula C11H13FO3 and a molecular weight of 212.22 g/mol. IUPAC name: 3-[2-(4-fluorophenyl)ethoxy]propanoic acid. InChIKey: HLVRPSIPLKTMCW-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13FO3
Molecular weight212.22 g/mol
IUPAC name3-[2-(4-fluorophenyl)ethoxy]propanoic acid
InChIKeyHLVRPSIPLKTMCW-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1CCOCCC(=O)O)F

Computed by PubChem (NCBI)