cas: 863668-07-9 — see every product listed under this CAS number, including other names
2-(4-Fluorophenyl)thiazole-4-carboxylic acid 97% (CAS 863668-07-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A138683-1g |
| cas | 863668-07-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 431.56 Pln | |
| Ambeed | 25g | 1416.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A138683 |
2-(4-fluorophenyl)-1,3-thiazole-4-carboxylic acid (CAS 863668-07-9) is a chemical compound with the molecular formula C10H6FNO2S and a molecular weight of 223.23 g/mol. IUPAC name: 2-(4-fluorophenyl)-1,3-thiazole-4-carboxylic acid. InChIKey: VVZKBCLSODNUDS-UHFFFAOYSA-N.
| Molecular formula | C10H6FNO2S |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | VVZKBCLSODNUDS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=CS2)C(=O)O)F |
Computed by PubChem (NCBI)