CAS 262601-87-6 appears in our catalog under these names: 5-(4-Fluorobenzylidene)-1,3-thiazolidine-2,4-dione, 95%, 5-((4-Fluorobenzylidene)-2,4-thiazolidinedione. Offered by: Combi-blocks, TRC. Available pack sizes: 1g, 5g, 500mg.
5-[(4-fluorophenyl)methylidene]-1,3-thiazolidine-2,4-dione (CAS 262601-87-6) is a chemical compound with the molecular formula C10H6FNO2S and a molecular weight of 223.23 g/mol. IUPAC name: 5-[(4-fluorophenyl)methylidene]-1,3-thiazolidine-2,4-dione. InChIKey: XQEXVSOHLCLCFH-UHFFFAOYSA-N.
| Molecular formula | C10H6FNO2S |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | 5-[(4-fluorophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| InChIKey | XQEXVSOHLCLCFH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=C2C(=O)NC(=O)S2)F |
Computed by PubChem (NCBI)