Products 863668-07-9
CAS 863668-07-9 appears in our catalog under these names: 2-(4-Fluorophenyl)-1,3-thiazole-4-carboxylic acid, 98%, 2–(4–Fluorophenyl)thiazole–4–carboxylic acid, 2-(4-Fluorophenyl)thiazole-4-carboxylic acid 97%, 2-(4-Fluorophenyl)thiazole-4-carboxylic acid, 98%, 98%, 2-(4-Fluorophenyl)thiazole-4-carboxylic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 100g, 5g, 25g, 1g, 100mg, 250mg.
2-(4-fluorophenyl)-1,3-thiazole-4-carboxylic acid (CAS 863668-07-9) is a chemical compound with the molecular formula C10H6FNO2S and a molecular weight of 223.23 g/mol. IUPAC name: 2-(4-fluorophenyl)-1,3-thiazole-4-carboxylic acid. InChIKey: VVZKBCLSODNUDS-UHFFFAOYSA-N.
| Molecular formula | C10H6FNO2S |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | VVZKBCLSODNUDS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=CS2)C(=O)O)F |
Computed by PubChem (NCBI)