cas: 863668-07-9 — see every product listed under this CAS number, including other names
2-(4-Fluorophenyl)thiazole-4-carboxylic acid, 98%, 98% (CAS 863668-07-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115LYZ-100mg |
| cas | 863668-07-9 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 155.60 Pln | |
| Chemat | 5g | 347.60 Pln | |
| Chemat | 25g | 1475.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(4-fluorophenyl)-1,3-thiazole-4-carboxylic acid (CAS 863668-07-9) is a chemical compound with the molecular formula C10H6FNO2S and a molecular weight of 223.23 g/mol. IUPAC name: 2-(4-fluorophenyl)-1,3-thiazole-4-carboxylic acid. InChIKey: VVZKBCLSODNUDS-UHFFFAOYSA-N.
| Molecular formula | C10H6FNO2S |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | VVZKBCLSODNUDS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=CS2)C(=O)O)F |
Computed by PubChem (NCBI)