2-(4-Formylphenoxy)propanoic acid, 95%
cas: 51264-78-9 — see every product listed under this CAS number, including other names
2-(4-Formylphenoxy)propanoic acid, 95% (CAS 51264-78-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A297102-250mg |
| cas | 51264-78-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 270.25 Pln | |
| Ambeed | 5g | 592.88 Pln | |
| Ambeed | 10g | 782.00 Pln | |
| Ambeed | 25g | 1805.50 Pln | |
| BLDpharm | 250mg | 247.72 Pln | |
| BLDpharm | 1g | 286.59 Pln | |
| BLDpharm | 5g | 636.47 Pln | |
| BLDpharm | 10g | 841.95 Pln | |
| BLDpharm | 25g | 1941.56 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-(4-formylphenoxy)propanoic acid (CAS 51264-78-9) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 2-(4-formylphenoxy)propanoic acid. InChIKey: OIQBPASRUVCUAN-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 2-(4-formylphenoxy)propanoic acid |
| InChIKey | OIQBPASRUVCUAN-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)OC1=CC=C(C=C1)C=O |
Computed by PubChem (NCBI)