Products 51264-78-9
CAS 51264-78-9 appears in our catalog under these names: 2-(4-Formylphenoxy)propanoic acid, 98%, 2-(4-Formylphenoxy)propanoic acid, 2-(4-Formylphenoxy)propanoic acid 95%, 2-(4-formylphenoxy)propanoic acid, 97%(LC-MS),RG. Offered by: Combi-blocks, Biosynth, Ambeed, Fluorochem. Available pack sizes: 25g, 10g, 5g, 1g, 250mg.
2-(4-formylphenoxy)propanoic acid (CAS 51264-78-9) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 2-(4-formylphenoxy)propanoic acid. InChIKey: OIQBPASRUVCUAN-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 2-(4-formylphenoxy)propanoic acid |
| InChIKey | OIQBPASRUVCUAN-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)OC1=CC=C(C=C1)C=O |
Computed by PubChem (NCBI)