cas: 73852-88-7 — see every product listed under this CAS number, including other names
2-(4-Iodophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 98% (CAS 73852-88-7) is a chemical reagent available from Chemat. Available pack sizes: 100g, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A432658-100g |
| cas | 73852-88-7 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 4597.88 Pln | |
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 359.25 Pln | |
| Ambeed | 25g | 1482.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A432658 |
2-(4-iodophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 73852-88-7) is a chemical compound with the molecular formula C12H16BIO2 and a molecular weight of 329.97 g/mol. IUPAC name: 2-(4-iodophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: ACCWXFPZHMACEN-UHFFFAOYSA-N.
| Molecular formula | C12H16BIO2 |
|---|---|
| Molecular weight | 329.97 g/mol |
| IUPAC name | 2-(4-iodophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | ACCWXFPZHMACEN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)I |
Computed by PubChem (NCBI)