cas: 73852-88-7 — see every product listed under this CAS number, including other names
2-(4-Iodophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98% (CAS 73852-88-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g, 5g, 25g, 10g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114LKM-50mg |
| cas | 73852-88-7 |
| size | 50mg |
| availability | 150g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 78.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 232.40 Pln | |
| Chemat | 25g | 650.00 Pln | |
| Chemat | 10g | 352.40 Pln | |
| Chemat | 50g | 1163.60 Pln | |
| Chemat | 100g | 2128.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(4-iodophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 73852-88-7) is a chemical compound with the molecular formula C12H16BIO2 and a molecular weight of 329.97 g/mol. IUPAC name: 2-(4-iodophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: ACCWXFPZHMACEN-UHFFFAOYSA-N.
| Molecular formula | C12H16BIO2 |
|---|---|
| Molecular weight | 329.97 g/mol |
| IUPAC name | 2-(4-iodophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | ACCWXFPZHMACEN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)I |
Computed by PubChem (NCBI)