cas: 34715-60-1 — see every product listed under this CAS number, including other names
2-(4-Isobutylphenyl)propanoyl chloride 98% (CAS 34715-60-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1235221-250mg |
| cas | 34715-60-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 242.44 Pln | |
| Ambeed | 1g | 537.25 Pln | |
| Ambeed | 5g | 1699.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1235221 |
2-[4-(2-methylpropyl)phenyl]propanoyl chloride (CAS 34715-60-1) is a chemical compound with the molecular formula C13H17ClO and a molecular weight of 224.72 g/mol. IUPAC name: 2-[4-(2-methylpropyl)phenyl]propanoyl chloride. InChIKey: QXVRLFIKHYCFJS-UHFFFAOYSA-N.
| Molecular formula | C13H17ClO |
|---|---|
| Molecular weight | 224.72 g/mol |
| IUPAC name | 2-[4-(2-methylpropyl)phenyl]propanoyl chloride |
| InChIKey | QXVRLFIKHYCFJS-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=CC=C(C=C1)C(C)C(=O)Cl |
Computed by PubChem (NCBI)