cas: 34715-60-1 — see every product listed under this CAS number, including other names
2-(4-Isobutylphenyl)propanoyl chloride, 98%, 98% (CAS 34715-60-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C7SD-250mg |
| cas | 34715-60-1 |
| size | 250mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 203.60 Pln | |
| Chemat | 1g | 443.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[4-(2-methylpropyl)phenyl]propanoyl chloride (CAS 34715-60-1) is a chemical compound with the molecular formula C13H17ClO and a molecular weight of 224.72 g/mol. IUPAC name: 2-[4-(2-methylpropyl)phenyl]propanoyl chloride. InChIKey: QXVRLFIKHYCFJS-UHFFFAOYSA-N.
| Molecular formula | C13H17ClO |
|---|---|
| Molecular weight | 224.72 g/mol |
| IUPAC name | 2-[4-(2-methylpropyl)phenyl]propanoyl chloride |
| InChIKey | QXVRLFIKHYCFJS-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=CC=C(C=C1)C(C)C(=O)Cl |
Computed by PubChem (NCBI)