CAS 59477-82-6 appears in our catalog under these names: 1-(4-tert-Butyl-phenyl)-2-chloro-propan-1-one, 95%, 1-(4-tert-Butylphenyl)-2-chloropropan-1-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g, 2,5g.
1-(4-tert-butylphenyl)-2-chloropropan-1-one (CAS 59477-82-6) is a chemical compound with the molecular formula C13H17ClO and a molecular weight of 224.72 g/mol. IUPAC name: 1-(4-tert-butylphenyl)-2-chloropropan-1-one. InChIKey: RXZLQSCORMCHDF-UHFFFAOYSA-N.
| Molecular formula | C13H17ClO |
|---|---|
| Molecular weight | 224.72 g/mol |
| IUPAC name | 1-(4-tert-butylphenyl)-2-chloropropan-1-one |
| InChIKey | RXZLQSCORMCHDF-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC=C(C=C1)C(C)(C)C)Cl |
Computed by PubChem (NCBI)