CAS 34715-60-1 appears in our catalog under these names: 2-[4-(Isobutyl)phenyl]propionyl chloride, 95%, 2-(4-Isobutylphenyl)propanoyl chloride 98%, 2-(4-Isobutylphenyl)propanoyl chloride, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 5g.
2-[4-(2-methylpropyl)phenyl]propanoyl chloride (CAS 34715-60-1) is a chemical compound with the molecular formula C13H17ClO and a molecular weight of 224.72 g/mol. IUPAC name: 2-[4-(2-methylpropyl)phenyl]propanoyl chloride. InChIKey: QXVRLFIKHYCFJS-UHFFFAOYSA-N.
| Molecular formula | C13H17ClO |
|---|---|
| Molecular weight | 224.72 g/mol |
| IUPAC name | 2-[4-(2-methylpropyl)phenyl]propanoyl chloride |
| InChIKey | QXVRLFIKHYCFJS-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=CC=C(C=C1)C(C)C(=O)Cl |
Computed by PubChem (NCBI)