Products 34715-60-1

CAS 34715-60-1 appears in our catalog under these names: 2-[4-(Isobutyl)phenyl]propionyl chloride, 95%, 2-(4-Isobutylphenyl)propanoyl chloride, 98%, 98%, 2-(4-Isobutylphenyl)propanoyl chloride, 98%. Offered by: Combi-blocks, Chemat, Ambeed. Available pack sizes: 1g, 250mg, 5g.

Structural formula: {0} (CAS {1})

2-[4-(2-methylpropyl)phenyl]propanoyl chloride (CAS 34715-60-1) is a chemical compound with the molecular formula C13H17ClO and a molecular weight of 224.72 g/mol. IUPAC name: 2-[4-(2-methylpropyl)phenyl]propanoyl chloride. InChIKey: QXVRLFIKHYCFJS-UHFFFAOYSA-N.

Identity
Molecular formulaC13H17ClO
Molecular weight224.72 g/mol
IUPAC name2-[4-(2-methylpropyl)phenyl]propanoyl chloride
InChIKeyQXVRLFIKHYCFJS-UHFFFAOYSA-N
SMILESCC(C)CC1=CC=C(C=C1)C(C)C(=O)Cl

Computed by PubChem (NCBI)