cas: 17897-49-3 — see every product listed under this CAS number, including other names
2-(4-Methoxy-1H-indol-3-yl)acetic acid, ≥97%, ≥97% (CAS 17897-49-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11VT12-100mg |
| cas | 17897-49-3 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 765.20 Pln | |
| Chemat | 250mg | 890.00 Pln | |
| Chemat | 1g | 2027.60 Pln | |
| Chemat | 5g | 4278.80 Pln | |
| Chemat | 10g | 8469.20 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
2-(4-methoxy-1H-indol-3-yl)acetic acid (CAS 17897-49-3) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: 2-(4-methoxy-1H-indol-3-yl)acetic acid. InChIKey: LASOXKFMZMXTOD-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | 2-(4-methoxy-1H-indol-3-yl)acetic acid |
| InChIKey | LASOXKFMZMXTOD-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1C(=CN2)CC(=O)O |
Computed by PubChem (NCBI)