cas: 98395-62-1 — see every product listed under this CAS number, including other names
2-(4-Nitrophenoxy)ethanamine hydrochloride 98% (CAS 98395-62-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A680831-250mg |
| cas | 98395-62-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 242.44 Pln | |
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 848.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A680831 |
2-(4-nitrophenoxy)ethanamine;hydrochloride (CAS 98395-62-1) is a chemical compound with the molecular formula C8H11ClN2O3 and a molecular weight of 218.64 g/mol. IUPAC name: 2-(4-nitrophenoxy)ethanamine;hydrochloride. InChIKey: UIMOMIHYFRGWIG-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2O3 |
|---|---|
| Molecular weight | 218.64 g/mol |
| IUPAC name | 2-(4-nitrophenoxy)ethanamine;hydrochloride |
| InChIKey | UIMOMIHYFRGWIG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OCCN.Cl |
Computed by PubChem (NCBI)