CAS 98395-65-4 appears in our catalog under these names: 2-(2-Nitrophenoxy)ethylamine hydrochloride, 98%, 2–(2–Nitrophenoxy)ethylamine Hydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 1g, 250mg.
2-(2-nitrophenoxy)ethanamine;hydrochloride (CAS 98395-65-4) is a chemical compound with the molecular formula C8H11ClN2O3 and a molecular weight of 218.64 g/mol. IUPAC name: 2-(2-nitrophenoxy)ethanamine;hydrochloride. InChIKey: RXKSKQFXCBODPH-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2O3 |
|---|---|
| Molecular weight | 218.64 g/mol |
| IUPAC name | 2-(2-nitrophenoxy)ethanamine;hydrochloride |
| InChIKey | RXKSKQFXCBODPH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])OCCN.Cl |
Computed by PubChem (NCBI)